C21H23F3N2O2 — CID 100758512
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 100758512) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 100758512 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H23F3N2O2/c22-21(23,24)18-7-3-8-19(13-18)28-15-20(27)25-10-4-11-26-12-9-16-5-1-2-6-17(16)14-26/h1-3,5-8,13H,4,9-12,14-15H2,(H,25,27) |
| InChIKey | VACAQUAGBDFNGF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|