C25H34N4O2 — CID 134334330
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[3-(4-methylpiperazin-1-yl)phenoxy]acetamide (PubChem CID 134334330) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[3-(4-methylpiperazin-1-yl)phenoxy]acetamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[3-(4-methylpiperazin-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 134334330 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-[3-(4-methylpiperazin-1-yl)phenoxy]acetamide |
| SMILES | CN1CCN(c2cccc(OCC(=O)NCCCN3CCc4ccccc4C3)c2)CC1 |
| InChI | InChI=1S/C25H34N4O2/c1-27-14-16-29(17-15-27)23-8-4-9-24(18-23)31-20-25(30)26-11-5-12-28-13-10-21-6-2-3-7-22(21)19-28/h2-4,6-9,18H,5,10-17,19-20H2,1H3,(H,26,30) |
| InChIKey | UBVJGODSGPSTSG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|