C29H33N3O3S — CID 91598867
2-(4-tert-butylphenyl)sulfonyl-8a-[[4-(1H-pyrazol-4-yl)phenyl]methyl]-3,5,7,8-tetrahydro-1H-isoquinolin-6-one (PubChem CID 91598867) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfonyl-8a-[[4-(1H-pyrazol-4-yl)phenyl]methyl]-3,5,7,8-tetrahydro-1H-isoquinolin-6-one.
| Compound Name | 2-(4-tert-butylphenyl)sulfonyl-8a-[[4-(1H-pyrazol-4-yl)phenyl]methyl]-3,5,7,8-tetrahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 91598867 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfonyl-8a-[[4-(1H-pyrazol-4-yl)phenyl]methyl]-3,5,7,8-tetrahydro-1H-isoquinolin-6-one |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CC=C3CC(=O)CCC3(Cc3ccc(-c4cn[nH]c4)cc3)C2)cc1 |
| InChI | InChI=1S/C29H33N3O3S/c1-28(2,3)24-8-10-27(11-9-24)36(34,35)32-15-13-25-16-26(33)12-14-29(25,20-32)17-21-4-6-22(7-5-21)23-18-30-31-19-23/h4-11,13,18-19H,12,14-17,20H2,1-3H3,(H,30,31) |
| InChIKey | VJHBBJVIOIQCRP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|