C28H34N2O3S — CID 143108732
[8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-6-methoxy-1,3,4,8-tetrahydroisoquinolin-7-yl]methanimine (PubChem CID 143108732) has the molecular formula C28H34N2O3S and a molecular weight of 478.66 g/mol. Its IUPAC name is [8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-6-methoxy-1,3,4,8-tetrahydroisoquinolin-7-yl]methanimine.
| Compound Name | [8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-6-methoxy-1,3,4,8-tetrahydroisoquinolin-7-yl]methanimine |
|---|---|
| PubChem CID | 143108732 |
| Molecular Formula | C28H34N2O3S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | [8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-6-methoxy-1,3,4,8-tetrahydroisoquinolin-7-yl]methanimine |
| SMILES | [H]/N=C/C1=C(OC)C=C2CCN(S(=O)(=O)c3ccc(C(C)(C)C)cc3)CC2(Cc2ccccc2)C1 |
| InChI | InChI=1S/C28H34N2O3S/c1-27(2,3)23-10-12-25(13-11-23)34(31,32)30-15-14-24-16-26(33-4)22(19-29)18-28(24,20-30)17-21-8-6-5-7-9-21/h5-13,16,19,29H,14-15,17-18,20H2,1-4H3/b29-19+ |
| InChIKey | XCXCWMMNSFPEHF-VUTHCHCSSA-N |
| XLogP | 5.49 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|