C27H31NO4S — CID 58333349
(7Z,8aS)-8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-7-(hydroxymethylidene)-1,3,4,8-tetrahydroisoquinolin-6-one (PubChem CID 58333349) has the molecular formula C27H31NO4S and a molecular weight of 465.62 g/mol. Its IUPAC name is (7Z,8aS)-8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-7-(hydroxymethylidene)-1,3,4,8-tetrahydroisoquinolin-6-one.
| Compound Name | (7Z,8aS)-8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-7-(hydroxymethylidene)-1,3,4,8-tetrahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 58333349 |
| Molecular Formula | C27H31NO4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | (7Z,8aS)-8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-7-(hydroxymethylidene)-1,3,4,8-tetrahydroisoquinolin-6-one |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCC3=CC(=O)/C(=C\O)C[C@]3(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H31NO4S/c1-26(2,3)22-9-11-24(12-10-22)33(31,32)28-14-13-23-15-25(30)21(18-29)17-27(23,19-28)16-20-7-5-4-6-8-20/h4-12,15,18,29H,13-14,16-17,19H2,1-3H3/b21-18-/t27-/m1/s1 |
| InChIKey | OMUUYSVGVAHHRG-GQHPKTMLSA-N |
| XLogP | 4.95 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|