C26H31NO3S — CID 89090269
(6S,8aR)-8a-benzyl-6-methoxy-2-(4-prop-1-en-2-ylphenyl)sulfonyl-1,3,4,6,7,8-hexahydroisoquinoline (PubChem CID 89090269) has the molecular formula C26H31NO3S and a molecular weight of 437.61 g/mol. Its IUPAC name is (6S,8aR)-8a-benzyl-6-methoxy-2-(4-prop-1-en-2-ylphenyl)sulfonyl-1,3,4,6,7,8-hexahydroisoquinoline.
| Compound Name | (6S,8aR)-8a-benzyl-6-methoxy-2-(4-prop-1-en-2-ylphenyl)sulfonyl-1,3,4,6,7,8-hexahydroisoquinoline |
|---|---|
| PubChem CID | 89090269 |
| Molecular Formula | C26H31NO3S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (6S,8aR)-8a-benzyl-6-methoxy-2-(4-prop-1-en-2-ylphenyl)sulfonyl-1,3,4,6,7,8-hexahydroisoquinoline |
| SMILES | C=C(C)c1ccc(S(=O)(=O)N2CCC3=C[C@@H](OC)CC[C@]3(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C26H31NO3S/c1-20(2)22-9-11-25(12-10-22)31(28,29)27-16-14-23-17-24(30-3)13-15-26(23,19-27)18-21-7-5-4-6-8-21/h4-12,17,24H,1,13-16,18-19H2,2-3H3/t24-,26-/m0/s1 |
| InChIKey | BXBIFCVYOGLUBT-AHWVRZQESA-N |
| XLogP | 5.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|