C22H24N2O3S — CID 87494427
(NZ)-N-[2-(benzenesulfonyl)-8a-benzyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-ylidene]hydroxylamine (PubChem CID 87494427) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (NZ)-N-[2-(benzenesulfonyl)-8a-benzyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2-(benzenesulfonyl)-8a-benzyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 87494427 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (NZ)-N-[2-(benzenesulfonyl)-8a-benzyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-ylidene]hydroxylamine |
| SMILES | O=S(=O)(c1ccccc1)N1CCC2=C/C(=N\O)CCC2(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H24N2O3S/c25-23-20-11-13-22(16-18-7-3-1-4-8-18)17-24(14-12-19(22)15-20)28(26,27)21-9-5-2-6-10-21/h1-10,15,25H,11-14,16-17H2/b23-20- |
| InChIKey | UFWVLGNLIKDXHZ-ATJXCDBQSA-N |
| XLogP | 3.86 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|