C27H31NO4S — CID 123704075
8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-6-oxo-3,4,7,8-tetrahydro-1H-isoquinoline-7-carbaldehyde (PubChem CID 123704075) has the molecular formula C27H31NO4S and a molecular weight of 465.62 g/mol. Its IUPAC name is 8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-6-oxo-3,4,7,8-tetrahydro-1H-isoquinoline-7-carbaldehyde.
| Compound Name | 8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-6-oxo-3,4,7,8-tetrahydro-1H-isoquinoline-7-carbaldehyde |
|---|---|
| PubChem CID | 123704075 |
| Molecular Formula | C27H31NO4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 8a-benzyl-2-(4-tert-butylphenyl)sulfonyl-6-oxo-3,4,7,8-tetrahydro-1H-isoquinoline-7-carbaldehyde |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCC3=CC(=O)C(C=O)CC3(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H31NO4S/c1-26(2,3)22-9-11-24(12-10-22)33(31,32)28-14-13-23-15-25(30)21(18-29)17-27(23,19-28)16-20-7-5-4-6-8-20/h4-12,15,18,21H,13-14,16-17,19H2,1-3H3 |
| InChIKey | GJYRWDAUJFRVTP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|