C30H33N3O3S — CID 91058048
2-(4-tert-butylphenyl)sulfonyl-8a-[(4-pyrimidin-5-ylphenyl)methyl]-3,5,7,8-tetrahydro-1H-isoquinolin-6-one (PubChem CID 91058048) has the molecular formula C30H33N3O3S and a molecular weight of 515.68 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfonyl-8a-[(4-pyrimidin-5-ylphenyl)methyl]-3,5,7,8-tetrahydro-1H-isoquinolin-6-one.
| Compound Name | 2-(4-tert-butylphenyl)sulfonyl-8a-[(4-pyrimidin-5-ylphenyl)methyl]-3,5,7,8-tetrahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 91058048 |
| Molecular Formula | C30H33N3O3S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfonyl-8a-[(4-pyrimidin-5-ylphenyl)methyl]-3,5,7,8-tetrahydro-1H-isoquinolin-6-one |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CC=C3CC(=O)CCC3(Cc3ccc(-c4cncnc4)cc3)C2)cc1 |
| InChI | InChI=1S/C30H33N3O3S/c1-29(2,3)25-8-10-28(11-9-25)37(35,36)33-15-13-26-16-27(34)12-14-30(26,20-33)17-22-4-6-23(7-5-22)24-18-31-21-32-19-24/h4-11,13,18-19,21H,12,14-17,20H2,1-3H3 |
| InChIKey | DFPFWZIINBGNNA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|