C24H34N2O4S — CID 91549493
(8aS)-2-(4-tert-butylphenyl)sulfonyl-8a-(morpholin-4-ylmethyl)-3,5,7,8-tetrahydro-1H-isoquinolin-6-one (PubChem CID 91549493) has the molecular formula C24H34N2O4S and a molecular weight of 446.61 g/mol. Its IUPAC name is (8aS)-2-(4-tert-butylphenyl)sulfonyl-8a-(morpholin-4-ylmethyl)-3,5,7,8-tetrahydro-1H-isoquinolin-6-one.
| Compound Name | (8aS)-2-(4-tert-butylphenyl)sulfonyl-8a-(morpholin-4-ylmethyl)-3,5,7,8-tetrahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 91549493 |
| Molecular Formula | C24H34N2O4S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (8aS)-2-(4-tert-butylphenyl)sulfonyl-8a-(morpholin-4-ylmethyl)-3,5,7,8-tetrahydro-1H-isoquinolin-6-one |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CC=C3CC(=O)CC[C@]3(CN3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C24H34N2O4S/c1-23(2,3)19-4-6-22(7-5-19)31(28,29)26-11-9-20-16-21(27)8-10-24(20,18-26)17-25-12-14-30-15-13-25/h4-7,9H,8,10-18H2,1-3H3/t24-/m0/s1 |
| InChIKey | HVBBMSAJRLMDNP-DEOSSOPVSA-N |
| XLogP | 2.99 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|