C22H36N2O2S — CID 46287342
1-[[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]methyl]-4-methylpiperidine (PubChem CID 46287342) has the molecular formula C22H36N2O2S and a molecular weight of 392.61 g/mol. Its IUPAC name is 1-[[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]methyl]-4-methylpiperidine.
| Compound Name | 1-[[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]methyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 46287342 |
| Molecular Formula | C22H36N2O2S |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-[[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]methyl]-4-methylpiperidine |
| SMILES | CC1CCN(CC2CCN(S(=O)(=O)c3ccc(C(C)(C)C)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H36N2O2S/c1-18-9-13-23(14-10-18)17-19-11-15-24(16-12-19)27(25,26)21-7-5-20(6-8-21)22(2,3)4/h5-8,18-19H,9-17H2,1-4H3 |
| InChIKey | HGXLFIZUODWEJV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |