C28H26FNO3S — CID 91019749
8a-benzyl-2-[4-(4-fluorophenyl)phenyl]sulfonyl-3,5,7,8-tetrahydro-1H-isoquinolin-6-one (PubChem CID 91019749) has the molecular formula C28H26FNO3S and a molecular weight of 475.59 g/mol. Its IUPAC name is 8a-benzyl-2-[4-(4-fluorophenyl)phenyl]sulfonyl-3,5,7,8-tetrahydro-1H-isoquinolin-6-one.
| Compound Name | 8a-benzyl-2-[4-(4-fluorophenyl)phenyl]sulfonyl-3,5,7,8-tetrahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 91019749 |
| Molecular Formula | C28H26FNO3S |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 8a-benzyl-2-[4-(4-fluorophenyl)phenyl]sulfonyl-3,5,7,8-tetrahydro-1H-isoquinolin-6-one |
| SMILES | O=C1CCC2(Cc3ccccc3)CN(S(=O)(=O)c3ccc(-c4ccc(F)cc4)cc3)CC=C2C1 |
| InChI | InChI=1S/C28H26FNO3S/c29-25-10-6-22(7-11-25)23-8-12-27(13-9-23)34(32,33)30-17-15-24-18-26(31)14-16-28(24,20-30)19-21-4-2-1-3-5-21/h1-13,15H,14,16-20H2 |
| InChIKey | ULLIAFWATHTELK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|