C18H23NO — CID 59214126
8a-benzyl-2-ethyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one (PubChem CID 59214126) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 8a-benzyl-2-ethyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one.
| Compound Name | 8a-benzyl-2-ethyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 59214126 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 8a-benzyl-2-ethyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one |
| SMILES | CCN1CCC2=CC(=O)CCC2(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H23NO/c1-2-19-11-9-16-12-17(20)8-10-18(16,14-19)13-15-6-4-3-5-7-15/h3-7,12H,2,8-11,13-14H2,1H3 |
| InChIKey | GWFCSUNTJHMICU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |