C22H22O2 — CID 11726899
(4aS)-4a-benzyl-7-methoxy-3,4,9,10-tetrahydrophenanthren-2-one (PubChem CID 11726899) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (4aS)-4a-benzyl-7-methoxy-3,4,9,10-tetrahydrophenanthren-2-one.
| Compound Name | (4aS)-4a-benzyl-7-methoxy-3,4,9,10-tetrahydrophenanthren-2-one |
|---|---|
| PubChem CID | 11726899 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (4aS)-4a-benzyl-7-methoxy-3,4,9,10-tetrahydrophenanthren-2-one |
| SMILES | COc1ccc2c(c1)CCC1=CC(=O)CC[C@]12Cc1ccccc1 |
| InChI | InChI=1S/C22H22O2/c1-24-20-9-10-21-17(13-20)7-8-18-14-19(23)11-12-22(18,21)15-16-5-3-2-4-6-16/h2-6,9-10,13-14H,7-8,11-12,15H2,1H3/t22-/m0/s1 |
| InChIKey | CDXXFXPTTWOXBC-QFIPXVFZSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |