C31H34O4 — CID 157082028
7-hydroxy-4a-methyl-3,4,9,10-tetrahydrophenanthren-2-one;7-methoxy-4a-methyl-3,4,9,10-tetrahydrophenanthren-2-one (PubChem CID 157082028) has the molecular formula C31H34O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 7-hydroxy-4a-methyl-3,4,9,10-tetrahydrophenanthren-2-one;7-methoxy-4a-methyl-3,4,9,10-tetrahydrophenanthren-2-one.
| Compound Name | 7-hydroxy-4a-methyl-3,4,9,10-tetrahydrophenanthren-2-one;7-methoxy-4a-methyl-3,4,9,10-tetrahydrophenanthren-2-one |
|---|---|
| PubChem CID | 157082028 |
| Molecular Formula | C31H34O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 7-hydroxy-4a-methyl-3,4,9,10-tetrahydrophenanthren-2-one;7-methoxy-4a-methyl-3,4,9,10-tetrahydrophenanthren-2-one |
| SMILES | CC12CCC(=O)C=C1CCc1cc(O)ccc12.COc1ccc2c(c1)CCC1=CC(=O)CCC12C |
| InChI | InChI=1S/C16H18O2.C15H16O2/c1-16-8-7-13(17)10-12(16)4-3-11-9-14(18-2)5-6-15(11)16;1-15-7-6-13(17)9-11(15)3-2-10-8-12(16)4-5-14(10)15/h5-6,9-10H,3-4,7-8H2,1-2H3;4-5,8-9,16H,2-3,6-7H2,1H3 |
| InChIKey | ADQSMFQHRKZSAV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |