C27H23NO4 — CID 68581265
(4aR)-4a-benzyl-7-(4-nitrophenoxy)-3,4,9,10-tetrahydrophenanthren-2-one (PubChem CID 68581265) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is (4aR)-4a-benzyl-7-(4-nitrophenoxy)-3,4,9,10-tetrahydrophenanthren-2-one.
| Compound Name | (4aR)-4a-benzyl-7-(4-nitrophenoxy)-3,4,9,10-tetrahydrophenanthren-2-one |
|---|---|
| PubChem CID | 68581265 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (4aR)-4a-benzyl-7-(4-nitrophenoxy)-3,4,9,10-tetrahydrophenanthren-2-one |
| SMILES | O=C1C=C2CCc3cc(Oc4ccc([N+](=O)[O-])cc4)ccc3[C@@]2(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H23NO4/c29-23-14-15-27(18-19-4-2-1-3-5-19)21(17-23)7-6-20-16-25(12-13-26(20)27)32-24-10-8-22(9-11-24)28(30)31/h1-5,8-13,16-17H,6-7,14-15,18H2/t27-/m1/s1 |
| InChIKey | ZGLINRRAGQLKNB-HHHXNRCGSA-N |
| XLogP | 6.10 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|