C18H17NO5 — CID 89239940
1,1-dimethoxy-6-(4-nitrophenyl)-3,4-dihydronaphthalen-2-one (PubChem CID 89239940) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1,1-dimethoxy-6-(4-nitrophenyl)-3,4-dihydronaphthalen-2-one.
| Compound Name | 1,1-dimethoxy-6-(4-nitrophenyl)-3,4-dihydronaphthalen-2-one |
|---|---|
| PubChem CID | 89239940 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1,1-dimethoxy-6-(4-nitrophenyl)-3,4-dihydronaphthalen-2-one |
| SMILES | COC1(OC)C(=O)CCc2cc(-c3ccc([N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C18H17NO5/c1-23-18(24-2)16-9-5-13(11-14(16)6-10-17(18)20)12-3-7-15(8-4-12)19(21)22/h3-5,7-9,11H,6,10H2,1-2H3 |
| InChIKey | JOCJMXQWIDMRSP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|