C26H31NO2 — CID 166832905
(13R)-9-benzyl-3,16-dimethoxy-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-13-amine (PubChem CID 166832905) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (13R)-9-benzyl-3,16-dimethoxy-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-13-amine.
| Compound Name | (13R)-9-benzyl-3,16-dimethoxy-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-13-amine |
|---|---|
| PubChem CID | 166832905 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (13R)-9-benzyl-3,16-dimethoxy-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-13-amine |
| SMILES | COc1ccc2c(c1)CCC1=C3CC(OC)C[C@]3(N)CCC12Cc1ccccc1 |
| InChI | InChI=1S/C26H31NO2/c1-28-20-9-11-22-19(14-20)8-10-23-24-15-21(29-2)17-26(24,27)13-12-25(22,23)16-18-6-4-3-5-7-18/h3-7,9,11,14,21H,8,10,12-13,15-17,27H2,1-2H3/t21?,25?,26-/m1/s1 |
| InChIKey | MRMWCKBVBZFREG-HFYIDVTOSA-N |
| XLogP | 4.72 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|