C31H34N2O — CID 177379433
(9S,13S,16S)-9-benzyl-13-methyl-3-[(2-methyl-3-pyridinyl)amino]-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol (PubChem CID 177379433) has the molecular formula C31H34N2O and a molecular weight of 450.63 g/mol. Its IUPAC name is (9S,13S,16S)-9-benzyl-13-methyl-3-[(2-methyl-3-pyridinyl)amino]-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol.
| Compound Name | (9S,13S,16S)-9-benzyl-13-methyl-3-[(2-methyl-3-pyridinyl)amino]-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 177379433 |
| Molecular Formula | C31H34N2O |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | (9S,13S,16S)-9-benzyl-13-methyl-3-[(2-methyl-3-pyridinyl)amino]-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol |
| SMILES | Cc1ncccc1Nc1ccc2c(c1)CCC1=C3C[C@@H](O)C[C@]3(C)CC[C@]12Cc1ccccc1 |
| InChI | InChI=1S/C31H34N2O/c1-21-29(9-6-16-32-21)33-24-11-13-26-23(17-24)10-12-27-28-18-25(34)20-30(28,2)14-15-31(26,27)19-22-7-4-3-5-8-22/h3-9,11,13,16-17,25,33-34H,10,12,14-15,18-20H2,1-2H3/t25-,30+,31-/m1/s1 |
| InChIKey | DFZYMRBKXQWSTE-SDDUWZMOSA-N |
| XLogP | 6.81 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|