C26H30O3 — CID 166092054
(9R)-3,16-dimethoxy-9-(4-methoxyphenyl)-6,7,11,12,13,15,16,17-octahydrocyclopenta[a]phenanthrene (PubChem CID 166092054) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is (9R)-3,16-dimethoxy-9-(4-methoxyphenyl)-6,7,11,12,13,15,16,17-octahydrocyclopenta[a]phenanthrene.
| Compound Name | (9R)-3,16-dimethoxy-9-(4-methoxyphenyl)-6,7,11,12,13,15,16,17-octahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 166092054 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (9R)-3,16-dimethoxy-9-(4-methoxyphenyl)-6,7,11,12,13,15,16,17-octahydrocyclopenta[a]phenanthrene |
| SMILES | COc1ccc([C@]23CCC4CC(OC)CC4=C2CCc2cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C26H30O3/c1-27-20-7-5-19(6-8-20)26-13-12-17-14-22(29-3)16-23(17)25(26)10-4-18-15-21(28-2)9-11-24(18)26/h5-9,11,15,17,22H,4,10,12-14,16H2,1-3H3/t17?,22?,26-/m0/s1 |
| InChIKey | QHAGLNVKNLFKPQ-OMUJPZFUSA-N |
| XLogP | 5.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|