C20H24O2 — CID 102116913
(10bR,12aR)-8-methoxy-12a-methyl-1,3,4,5,6,10b,11,12-octahydrochrysen-2-one (PubChem CID 102116913) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (10bR,12aR)-8-methoxy-12a-methyl-1,3,4,5,6,10b,11,12-octahydrochrysen-2-one.
| Compound Name | (10bR,12aR)-8-methoxy-12a-methyl-1,3,4,5,6,10b,11,12-octahydrochrysen-2-one |
|---|---|
| PubChem CID | 102116913 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (10bR,12aR)-8-methoxy-12a-methyl-1,3,4,5,6,10b,11,12-octahydrochrysen-2-one |
| SMILES | COc1ccc2c(c1)CCC1=C3CCC(=O)C[C@@]3(C)CC[C@H]12 |
| InChI | InChI=1S/C20H24O2/c1-20-10-9-17-16-7-5-15(22-2)11-13(16)3-6-18(17)19(20)8-4-14(21)12-20/h5,7,11,17H,3-4,6,8-10,12H2,1-2H3/t17-,20+/m0/s1 |
| InChIKey | OLKKCLNCXGLDPP-FXAWDEMLSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|