C23H30O3 — CID 71619118
[(9S,13S,17S)-3-methoxy-6,6,13-trimethyl-9,11,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 71619118) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is [(9S,13S,17S)-3-methoxy-6,6,13-trimethyl-9,11,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(9S,13S,17S)-3-methoxy-6,6,13-trimethyl-9,11,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 71619118 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [(9S,13S,17S)-3-methoxy-6,6,13-trimethyl-9,11,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COc1ccc2c(c1)C(C)(C)CC1=C3CC[C@H](OC(C)=O)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C23H30O3/c1-14(24)26-21-9-8-19-18-13-22(2,3)20-12-15(25-5)6-7-17(20)16(18)10-11-23(19,21)4/h6-7,12,16,21H,8-11,13H2,1-5H3/t16-,21+,23+/m1/s1 |
| InChIKey | FJRSUFCAFVXQLQ-HNKPZJSLSA-N |
| XLogP | 5.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|