C22H27ClO3 — CID 88817676
[(8R,9S,13R,14S,17S)-13-(1-chloroethenyl)-3-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 88817676) has the molecular formula C22H27ClO3 and a molecular weight of 374.91 g/mol. Its IUPAC name is [(8R,9S,13R,14S,17S)-13-(1-chloroethenyl)-3-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,13R,14S,17S)-13-(1-chloroethenyl)-3-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 88817676 |
| Molecular Formula | C22H27ClO3 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [(8R,9S,13R,14S,17S)-13-(1-chloroethenyl)-3-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C=C(Cl)[C@]12CC[C@@H]3c4ccc(OC)cc4CC[C@H]3[C@@H]1CC[C@@H]2OC(C)=O |
| InChI | InChI=1S/C22H27ClO3/c1-13(23)22-11-10-18-17-7-5-16(25-3)12-15(17)4-6-19(18)20(22)8-9-21(22)26-14(2)24/h5,7,12,18-21H,1,4,6,8-11H2,2-3H3/t18-,19-,20+,21+,22-/m1/s1 |
| InChIKey | POAYFJNXLGPMDL-LXHROKJGSA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |