C21H26O3S — CID 5255817
(8-methoxy-12a-methyl-1,2,4,4a,5,6,11,12-octahydronaphtho[1,2-h]isothiochromen-1-yl) acetate (PubChem CID 5255817) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is (8-methoxy-12a-methyl-1,2,4,4a,5,6,11,12-octahydronaphtho[1,2-h]isothiochromen-1-yl) acetate.
| Compound Name | (8-methoxy-12a-methyl-1,2,4,4a,5,6,11,12-octahydronaphtho[1,2-h]isothiochromen-1-yl) acetate |
|---|---|
| PubChem CID | 5255817 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (8-methoxy-12a-methyl-1,2,4,4a,5,6,11,12-octahydronaphtho[1,2-h]isothiochromen-1-yl) acetate |
| SMILES | COc1ccc2c(c1)CCC1=C2CCC2(C)C(OC(C)=O)CSCC12 |
| InChI | InChI=1S/C21H26O3S/c1-13(22)24-20-12-25-11-19-18-6-4-14-10-15(23-3)5-7-16(14)17(18)8-9-21(19,20)2/h5,7,10,19-20H,4,6,8-9,11-12H2,1-3H3 |
| InChIKey | ZWEYNXQHENMKBR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |