C21H26O2 — CID 54537119
(13R,14S)-3-methoxy-13-propan-2-yl-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 54537119) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (13R,14S)-3-methoxy-13-propan-2-yl-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (13R,14S)-3-methoxy-13-propan-2-yl-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 54537119 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (13R,14S)-3-methoxy-13-propan-2-yl-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | COc1ccc2c(c1)CCC1=C2CC[C@]2(C(C)C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H26O2/c1-13(2)21-11-10-17-16-7-5-15(23-3)12-14(16)4-6-18(17)19(21)8-9-20(21)22/h5,7,12-13,19H,4,6,8-11H2,1-3H3/t19-,21+/m0/s1 |
| InChIKey | ZAOGZRLYEXWJNB-PZJWPPBQSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |