C21H24O2 — CID 626247
8-methoxy-1,4a-dimethyl-3,4,5,6,11,12-hexahydrochrysen-2-one (PubChem CID 626247) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 8-methoxy-1,4a-dimethyl-3,4,5,6,11,12-hexahydrochrysen-2-one.
| Compound Name | 8-methoxy-1,4a-dimethyl-3,4,5,6,11,12-hexahydrochrysen-2-one |
|---|---|
| PubChem CID | 626247 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 8-methoxy-1,4a-dimethyl-3,4,5,6,11,12-hexahydrochrysen-2-one |
| SMILES | COc1ccc2c(c1)CCC1=C2CCC2=C(C)C(=O)CCC21C |
| InChI | InChI=1S/C21H24O2/c1-13-18-9-7-17-16-6-5-15(23-3)12-14(16)4-8-19(17)21(18,2)11-10-20(13)22/h5-6,12H,4,7-11H2,1-3H3 |
| InChIKey | UEJMTFMZPQHESO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |