C20H20O4 — CID 12972206
[6-methoxy-2-(3-methoxyphenyl)-3,4-dihydronaphthalen-1-yl] acetate (PubChem CID 12972206) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is [6-methoxy-2-(3-methoxyphenyl)-3,4-dihydronaphthalen-1-yl] acetate.
| Compound Name | [6-methoxy-2-(3-methoxyphenyl)-3,4-dihydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 12972206 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | [6-methoxy-2-(3-methoxyphenyl)-3,4-dihydronaphthalen-1-yl] acetate |
| SMILES | COc1cccc(C2=C(OC(C)=O)c3ccc(OC)cc3CC2)c1 |
| InChI | InChI=1S/C20H20O4/c1-13(21)24-20-18(14-5-4-6-16(11-14)22-2)9-7-15-12-17(23-3)8-10-19(15)20/h4-6,8,10-12H,7,9H2,1-3H3 |
| InChIKey | WLGUOPJCFSEDOP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|