About (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate
(4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate (PubChem CID 90227768) has the molecular formula C13H13BrO4
and a molecular weight of 313.15 g/mol. Its IUPAC name is (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate.
Molecular Properties
| Compound Name | (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate |
| PubChem CID | 90227768 |
| Molecular Formula | C13H13BrO4 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate |
| SMILES | COc1ccc2c(c1)OCCC(Br)=C2OC(C)=O |
| InChI | InChI=1S/C13H13BrO4/c1-8(15)18-13-10-4-3-9(16-2)7-12(10)17-6-5-11(13)14/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | JDGKKTOTPVUGOS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate?
The IUPAC name of (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate (CID 90227768) is (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate.
What is the SMILES notation for (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate?
The canonical SMILES for (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate is COc1ccc2c(c1)OCCC(Br)=C2OC(C)=O.
What is the InChIKey of (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate?
The InChIKey is JDGKKTOTPVUGOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrO4/c1-8(15)18-13-10-4-3-9(16-2)7-12(10)17-6-5-11(13)14/h3-4,7H,5-6H2,1-2H3.
What are the key properties of (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate?
(4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate has a molecular weight of 313.15 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-8-methoxy-2,3-dihydro-1-benzoxepin-5-yl) acetate is sourced from PubChem (CID 90227768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).