C22H26O3 — CID 15454765
[(2S,4S,6R,7S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraenyl] acetate (PubChem CID 15454765) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is [(2S,4S,6R,7S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraenyl] acetate.
| Compound Name | [(2S,4S,6R,7S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraenyl] acetate |
|---|---|
| PubChem CID | 15454765 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [(2S,4S,6R,7S)-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraenyl] acetate |
| SMILES | COc1ccc2c(c1)CCC1=C2CC[C@]2(C)[C@H](OC(C)=O)C[C@@H]3C[C@@]132 |
| InChI | InChI=1S/C22H26O3/c1-13(23)25-20-11-15-12-22(15)19-7-4-14-10-16(24-3)5-6-17(14)18(19)8-9-21(20,22)2/h5-6,10,15,20H,4,7-9,11-12H2,1-3H3/t15-,20-,21-,22+/m1/s1 |
| InChIKey | HCDBNULLOFLTLB-FJGOKHBRSA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |