C20H20F2O — CID 6419760
(2R,4R,7R)-6-(difluoromethylidene)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraen-14-ol (PubChem CID 6419760) has the molecular formula C20H20F2O and a molecular weight of 314.38 g/mol. Its IUPAC name is (2R,4R,7R)-6-(difluoromethylidene)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraen-14-ol.
| Compound Name | (2R,4R,7R)-6-(difluoromethylidene)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraen-14-ol |
|---|---|
| PubChem CID | 6419760 |
| Molecular Formula | C20H20F2O |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (2R,4R,7R)-6-(difluoromethylidene)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraen-14-ol |
| SMILES | C[C@@]12CCC3=C(CCc4cc(O)ccc43)[C@]13C[C@@H]3CC2=C(F)F |
| InChI | InChI=1S/C20H20F2O/c1-19-7-6-15-14-4-3-13(23)8-11(14)2-5-16(15)20(19)10-12(20)9-17(19)18(21)22/h3-4,8,12,23H,2,5-7,9-10H2,1H3/t12-,19-,20+/m0/s1 |
| InChIKey | UJOINTKAUJAUDZ-OCCQLPPTSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |