C20H26O2 — CID 156531418
(9R,13R,16S)-9-ethyl-13-methyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 156531418) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (9R,13R,16S)-9-ethyl-13-methyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (9R,13R,16S)-9-ethyl-13-methyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 156531418 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (9R,13R,16S)-9-ethyl-13-methyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | CC[C@@]12CC[C@]3(C)C[C@H](O)CC3=C1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C20H26O2/c1-3-20-9-8-19(2)12-15(22)11-18(19)17(20)6-4-13-10-14(21)5-7-16(13)20/h5,7,10,15,21-22H,3-4,6,8-9,11-12H2,1-2H3/t15-,19-,20+/m1/s1 |
| InChIKey | VIZZBDQQIWGHNY-YSGRDPCXSA-N |
| XLogP | 4.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|