C21H29NO2 — CID 163883258
(9S,16S)-6-(1-aminoethyl)-9,13-dimethyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 163883258) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (9S,16S)-6-(1-aminoethyl)-9,13-dimethyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (9S,16S)-6-(1-aminoethyl)-9,13-dimethyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 163883258 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (9S,16S)-6-(1-aminoethyl)-9,13-dimethyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | CC(N)C1CC2=C3C[C@@H](O)CC3(C)CC[C@]2(C)c2ccc(O)cc21 |
| InChI | InChI=1S/C21H29NO2/c1-12(22)15-10-19-18-9-14(24)11-20(18,2)6-7-21(19,3)17-5-4-13(23)8-16(15)17/h4-5,8,12,14-15,23-24H,6-7,9-11,22H2,1-3H3/t12?,14-,15?,20?,21-/m1/s1 |
| InChIKey | NBYSEZIMYRMMTL-URQBCDPASA-N |
| XLogP | 3.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|