About 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol
7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol (PubChem CID 144629304) has the molecular formula C12H15FO
and a molecular weight of 194.25 g/mol. Its IUPAC name is 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol.
Molecular Properties
| Compound Name | 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol |
| PubChem CID | 144629304 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol |
| SMILES | CC1(C)CC(O)Cc2cc(F)ccc21 |
| InChI | InChI=1S/C12H15FO/c1-12(2)7-10(14)6-8-5-9(13)3-4-11(8)12/h3-5,10,14H,6-7H2,1-2H3 |
| InChIKey | VCQBZLPWAPNTRB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol?
The IUPAC name of 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol (CID 144629304) is 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol.
What is the SMILES notation for 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol?
The canonical SMILES for 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol is CC1(C)CC(O)Cc2cc(F)ccc21.
What is the InChIKey of 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol?
The InChIKey is VCQBZLPWAPNTRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO/c1-12(2)7-10(14)6-8-5-9(13)3-4-11(8)12/h3-5,10,14H,6-7H2,1-2H3.
What are the key properties of 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol?
7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol has a molecular weight of 194.25 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol is sourced from PubChem (CID 144629304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).