C10H12FN — CID 86334375
(2R)-5-fluoro-N-methyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 86334375) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is (2R)-5-fluoro-N-methyl-2,3-dihydro-1H-inden-2-amine.
| Compound Name | (2R)-5-fluoro-N-methyl-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 86334375 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (2R)-5-fluoro-N-methyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | CN[C@@H]1Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C10H12FN/c1-12-10-5-7-2-3-9(11)4-8(7)6-10/h2-4,10,12H,5-6H2,1H3/t10-/m1/s1 |
| InChIKey | ZBRRGXLECAUBCV-SNVBAGLBSA-N |
| XLogP | 1.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |