C9H8BrF — CID 130115402
2-bromo-5-fluoro-2,3-dihydro-1H-indene (PubChem CID 130115402) has the molecular formula C9H8BrF and a molecular weight of 215.06 g/mol. Its IUPAC name is 2-bromo-5-fluoro-2,3-dihydro-1H-indene.
| Compound Name | 2-bromo-5-fluoro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 130115402 |
| Molecular Formula | C9H8BrF |
| Molecular Weight | 215.06 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | 2-bromo-5-fluoro-2,3-dihydro-1H-indene |
| SMILES | Fc1ccc2c(c1)CC(Br)C2 |
| InChI | InChI=1S/C9H8BrF/c10-8-3-6-1-2-9(11)5-7(6)4-8/h1-2,5,8H,3-4H2 |
| InChIKey | NUNJHSAQPTZNLJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.06 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|