C13H17FOSi — CID 174079347
(4-fluoro-6,6a-dihydro-1H-cyclopropa[a]inden-1a-yl)oxy-trimethylsilane (PubChem CID 174079347) has the molecular formula C13H17FOSi and a molecular weight of 236.36 g/mol. Its IUPAC name is (4-fluoro-6,6a-dihydro-1H-cyclopropa[a]inden-1a-yl)oxy-trimethylsilane.
| Compound Name | (4-fluoro-6,6a-dihydro-1H-cyclopropa[a]inden-1a-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 174079347 |
| Molecular Formula | C13H17FOSi |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (4-fluoro-6,6a-dihydro-1H-cyclopropa[a]inden-1a-yl)oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC12CC1Cc1cc(F)ccc12 |
| InChI | InChI=1S/C13H17FOSi/c1-16(2,3)15-13-8-10(13)6-9-7-11(14)4-5-12(9)13/h4-5,7,10H,6,8H2,1-3H3 |
| InChIKey | QPSXAAQNTSBFNK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|