C20H24O2 — CID 11087764
(2R,4R,6S,7S)-4,7-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraene-6,14-diol (PubChem CID 11087764) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2R,4R,6S,7S)-4,7-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraene-6,14-diol.
| Compound Name | (2R,4R,6S,7S)-4,7-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraene-6,14-diol |
|---|---|
| PubChem CID | 11087764 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2R,4R,6S,7S)-4,7-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11(16),12,14-tetraene-6,14-diol |
| SMILES | C[C@@]12C[C@H](O)[C@@]3(C)CCC4=C(CCc5cc(O)ccc54)[C@@]13C2 |
| InChI | InChI=1S/C20H24O2/c1-18-10-17(22)19(2)8-7-15-14-5-4-13(21)9-12(14)3-6-16(15)20(18,19)11-18/h4-5,9,17,21-22H,3,6-8,10-11H2,1-2H3/t17-,18-,19+,20-/m0/s1 |
| InChIKey | OLLIOMGBZWBHPE-HAGHYFMRSA-N |
| XLogP | 4.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |