C19H22O2 — CID 91462796
(13R,16S)-13-methyl-15-methylidene-7,11,12,14,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 91462796) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (13R,16S)-13-methyl-15-methylidene-7,11,12,14,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (13R,16S)-13-methyl-15-methylidene-7,11,12,14,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 91462796 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (13R,16S)-13-methyl-15-methylidene-7,11,12,14,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | C=C1C2C3=C(CC[C@]2(C)C[C@@H]1O)c1ccc(O)cc1CC3 |
| InChI | InChI=1S/C19H22O2/c1-11-17(21)10-19(2)8-7-15-14-6-4-13(20)9-12(14)3-5-16(15)18(11)19/h4,6,9,17-18,20-21H,1,3,5,7-8,10H2,2H3/t17-,18?,19+/m0/s1 |
| InChIKey | WBWDIBXKCIGBCI-LJJQOFDWSA-N |
| XLogP | 3.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|