C25H28O2 — CID 90846649
(7R,8R,9S,13R,16R)-13-methyl-15-methylidene-7-phenyl-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 90846649) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (7R,8R,9S,13R,16R)-13-methyl-15-methylidene-7-phenyl-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (7R,8R,9S,13R,16R)-13-methyl-15-methylidene-7-phenyl-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 90846649 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (7R,8R,9S,13R,16R)-13-methyl-15-methylidene-7-phenyl-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | C=C1C2[C@H]3[C@H](CC[C@]2(C)C[C@H]1O)c1ccc(O)cc1C[C@H]3c1ccccc1 |
| InChI | InChI=1S/C25H28O2/c1-15-22(27)14-25(2)11-10-20-19-9-8-18(26)12-17(19)13-21(23(20)24(15)25)16-6-4-3-5-7-16/h3-9,12,20-24,26-27H,1,10-11,13-14H2,2H3/t20-,21+,22-,23+,24?,25-/m1/s1 |
| InChIKey | UJDRXYZCBZGCRS-FRZLVKPUSA-N |
| XLogP | 5.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|