C27H32O2 — CID 140506950
(7R,8R,9S,13R,14R,16R)-13-methyl-7-phenyl-15-prop-1-en-2-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol (PubChem CID 140506950) has the molecular formula C27H32O2 and a molecular weight of 388.55 g/mol. Its IUPAC name is (7R,8R,9S,13R,14R,16R)-13-methyl-7-phenyl-15-prop-1-en-2-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (7R,8R,9S,13R,14R,16R)-13-methyl-7-phenyl-15-prop-1-en-2-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 140506950 |
| Molecular Formula | C27H32O2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (7R,8R,9S,13R,14R,16R)-13-methyl-7-phenyl-15-prop-1-en-2-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol |
| SMILES | C=C(C)C1[C@H](O)C[C@@]2(C)CC[C@@H]3c4ccc(O)cc4C[C@@H](c4ccccc4)[C@H]3[C@H]12 |
| InChI | InChI=1S/C27H32O2/c1-16(2)24-23(29)15-27(3)12-11-21-20-10-9-19(28)13-18(20)14-22(25(21)26(24)27)17-7-5-4-6-8-17/h4-10,13,21-26,28-29H,1,11-12,14-15H2,2-3H3/t21-,22+,23-,24?,25+,26+,27-/m1/s1 |
| InChIKey | MBFGVJSHWZJSEB-TXZPQQFMSA-N |
| XLogP | 5.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|