C20H27FO2 — CID 91390695
(7R,8S,9S,13R,14S,16S)-7-(2-fluoroethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol (PubChem CID 91390695) has the molecular formula C20H27FO2 and a molecular weight of 318.43 g/mol. Its IUPAC name is (7R,8S,9S,13R,14S,16S)-7-(2-fluoroethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (7R,8S,9S,13R,14S,16S)-7-(2-fluoroethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 91390695 |
| Molecular Formula | C20H27FO2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (7R,8S,9S,13R,14S,16S)-7-(2-fluoroethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4C[C@H](CCF)[C@H]3[C@@H]1C[C@H](O)C2 |
| InChI | InChI=1S/C20H27FO2/c1-20-6-4-17-16-3-2-14(22)9-13(16)8-12(5-7-21)19(17)18(20)10-15(23)11-20/h2-3,9,12,15,17-19,22-23H,4-8,10-11H2,1H3/t12-,15-,17+,18-,19+,20+/m0/s1 |
| InChIKey | IUSPEEYUKFWCAY-UQGUHHHDSA-N |
| XLogP | 4.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |