C21H27FO2 — CID 91562297
(8R,9S,13R,14R,15S,16R)-15-(2-fluoroprop-2-enyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol (PubChem CID 91562297) has the molecular formula C21H27FO2 and a molecular weight of 330.44 g/mol. Its IUPAC name is (8R,9S,13R,14R,15S,16R)-15-(2-fluoroprop-2-enyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (8R,9S,13R,14R,15S,16R)-15-(2-fluoroprop-2-enyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 91562297 |
| Molecular Formula | C21H27FO2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (8R,9S,13R,14R,15S,16R)-15-(2-fluoroprop-2-enyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16-diol |
| SMILES | C=C(F)C[C@H]1[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@]2(C)C[C@H]1O |
| InChI | InChI=1S/C21H27FO2/c1-12(22)9-18-19(24)11-21(2)8-7-16-15-6-4-14(23)10-13(15)3-5-17(16)20(18)21/h4,6,10,16-20,23-24H,1,3,5,7-9,11H2,2H3/t16-,17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | ZXKWBNJFZPBSLT-UCGFNCKJSA-N |
| XLogP | 4.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |