C19H20O2 — CID 142144674
11-methyl-10-methylidenetricyclo[11.4.0.04,9]heptadeca-1(13),4(9),5,7,14,16-hexaene-6,16-diol (PubChem CID 142144674) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 11-methyl-10-methylidenetricyclo[11.4.0.04,9]heptadeca-1(13),4(9),5,7,14,16-hexaene-6,16-diol.
| Compound Name | 11-methyl-10-methylidenetricyclo[11.4.0.04,9]heptadeca-1(13),4(9),5,7,14,16-hexaene-6,16-diol |
|---|---|
| PubChem CID | 142144674 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 11-methyl-10-methylidenetricyclo[11.4.0.04,9]heptadeca-1(13),4(9),5,7,14,16-hexaene-6,16-diol |
| SMILES | C=C1c2ccc(O)cc2CCc2cc(O)ccc2CC1C |
| InChI | InChI=1S/C19H20O2/c1-12-9-14-5-6-17(20)10-15(14)3-4-16-11-18(21)7-8-19(16)13(12)2/h5-8,10-12,20-21H,2-4,9H2,1H3 |
| InChIKey | VSLIXZMQBRVSMC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |