C11H15NO — CID 95432710
(3R)-2,3-dimethyl-3,4-dihydro-1H-isoquinolin-6-ol (PubChem CID 95432710) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (3R)-2,3-dimethyl-3,4-dihydro-1H-isoquinolin-6-ol.
| Compound Name | (3R)-2,3-dimethyl-3,4-dihydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 95432710 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (3R)-2,3-dimethyl-3,4-dihydro-1H-isoquinolin-6-ol |
| SMILES | C[C@@H]1Cc2cc(O)ccc2CN1C |
| InChI | InChI=1S/C11H15NO/c1-8-5-10-6-11(13)4-3-9(10)7-12(8)2/h3-4,6,8,13H,5,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | XPMJTJCKARRATN-MRVPVSSYSA-N |
| XLogP | 1.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |