C11H14O2 — CID 105437540
6-methoxy-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 105437540) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-methoxy-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 6-methoxy-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 105437540 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 6-methoxy-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COC1CCc2cc(O)ccc2C1 |
| InChI | InChI=1S/C11H14O2/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h2,4,6,11-12H,3,5,7H2,1H3 |
| InChIKey | VVORGDVSNRUPRF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |