C12H14 — CID 145271864
(2S)-2,5-dimethyl-3-methylidene-1,2-dihydroindene (PubChem CID 145271864) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is (2S)-2,5-dimethyl-3-methylidene-1,2-dihydroindene.
| Compound Name | (2S)-2,5-dimethyl-3-methylidene-1,2-dihydroindene |
|---|---|
| PubChem CID | 145271864 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (2S)-2,5-dimethyl-3-methylidene-1,2-dihydroindene |
| SMILES | C=C1c2cc(C)ccc2C[C@@H]1C |
| InChI | InChI=1S/C12H14/c1-8-4-5-11-7-9(2)10(3)12(11)6-8/h4-6,9H,3,7H2,1-2H3/t9-/m0/s1 |
| InChIKey | FEURFBVWWUFKHU-VIFPVBQESA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |