About 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene
2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene (PubChem CID 162688004) has the molecular formula C11H11F
and a molecular weight of 162.21 g/mol. Its IUPAC name is 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene.
Analyze 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene?
The IUPAC name of 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene (CID 162688004) is 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene.
What is the SMILES notation for 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene?
The canonical SMILES for 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene is C=C1c2cc(C)ccc2CC1F.
What is the InChIKey of 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene?
The InChIKey is SEUQXWXRSPJNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F/c1-7-3-4-9-6-11(12)8(2)10(9)5-7/h3-5,11H,2,6H2,1H3.
What are the key properties of 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene?
2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene has a molecular weight of 162.21 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-methyl-3-methylidene-1,2-dihydroindene is sourced from PubChem (CID 162688004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).