C23H26O4 — CID 40654441
[(13R,17S)-3-acetyloxy-13-ethyl-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 40654441) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is [(13R,17S)-3-acetyloxy-13-ethyl-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(13R,17S)-3-acetyloxy-13-ethyl-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 40654441 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [(13R,17S)-3-acetyloxy-13-ethyl-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC[C@@]12CCC3=C(CCc4cc(OC(C)=O)ccc43)C1=CC[C@@H]2OC(C)=O |
| InChI | InChI=1S/C23H26O4/c1-4-23-12-11-19-18-8-6-17(26-14(2)24)13-16(18)5-7-20(19)21(23)9-10-22(23)27-15(3)25/h6,8-9,13,22H,4-5,7,10-12H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | RIJXZANIRYKMAD-XZOQPEGZSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|