C22H26O — CID 101362702
(13R)-17-ethenyl-13-ethyl-3-methoxy-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthrene (PubChem CID 101362702) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is (13R)-17-ethenyl-13-ethyl-3-methoxy-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthrene.
| Compound Name | (13R)-17-ethenyl-13-ethyl-3-methoxy-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 101362702 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (13R)-17-ethenyl-13-ethyl-3-methoxy-6,7,11,12,16,17-hexahydrocyclopenta[a]phenanthrene |
| SMILES | C=CC1CC=C2C3=C(CC[C@@]21CC)c1ccc(OC)cc1CC3 |
| InChI | InChI=1S/C22H26O/c1-4-16-7-11-21-20-9-6-15-14-17(23-3)8-10-18(15)19(20)12-13-22(16,21)5-2/h4,8,10-11,14,16H,1,5-7,9,12-13H2,2-3H3/t16?,22-/m1/s1 |
| InChIKey | ZKWGXAPPAWQLAP-VXNXSFHZSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|