C22H26O4 — CID 98504570
[(1R,13S,14S)-7-methoxy-1,14-dimethyl-17-oxo-14-tetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),5(10),6,8-tetraenyl] acetate (PubChem CID 98504570) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is [(1R,13S,14S)-7-methoxy-1,14-dimethyl-17-oxo-14-tetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),5(10),6,8-tetraenyl] acetate.
| Compound Name | [(1R,13S,14S)-7-methoxy-1,14-dimethyl-17-oxo-14-tetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),5(10),6,8-tetraenyl] acetate |
|---|---|
| PubChem CID | 98504570 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [(1R,13S,14S)-7-methoxy-1,14-dimethyl-17-oxo-14-tetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),5(10),6,8-tetraenyl] acetate |
| SMILES | COc1ccc2c(c1)CCC1=C2C[C@@H]2C(=O)[C@]1(C)CC[C@]2(C)OC(C)=O |
| InChI | InChI=1S/C22H26O4/c1-13(23)26-22(3)10-9-21(2)18-8-5-14-11-15(25-4)6-7-16(14)17(18)12-19(22)20(21)24/h6-7,11,19H,5,8-10,12H2,1-4H3/t19-,21-,22+/m1/s1 |
| InChIKey | IEWADZBTFLSQKS-FCEUIQTBSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |